C12H23N7O5 — CID 101098394
2-[[2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]acetyl]amino]acetic acid (PubChem CID 101098394) has the molecular formula C12H23N7O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-[[2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 101098394 |
| Molecular Formula | C12H23N7O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2-[[2-[[2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]acetyl]amino]acetic acid |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)NCC(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C12H23N7O5/c13-7(2-1-3-16-12(14)15)11(24)19-5-9(21)17-4-8(20)18-6-10(22)23/h7H,1-6,13H2,(H,17,21)(H,18,20)(H,19,24)(H,22,23)(H4,14,15,16)/t7-/m0/s1 |
| InChIKey | AQPXNTGWTAHITM-ZETCQYMHSA-N |
| XLogP | -4.20 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | -4.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|