C16H33N9O3 — CID 134188384
2-acetamido-5-(diaminomethylideneamino)-N-[2-[5-(diaminomethylideneamino)pentan-2-ylamino]-2-oxoethyl]pentanamide (PubChem CID 134188384) has the molecular formula C16H33N9O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is 2-acetamido-5-(diaminomethylideneamino)-N-[2-[5-(diaminomethylideneamino)pentan-2-ylamino]-2-oxoethyl]pentanamide.
| Compound Name | 2-acetamido-5-(diaminomethylideneamino)-N-[2-[5-(diaminomethylideneamino)pentan-2-ylamino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 134188384 |
| Molecular Formula | C16H33N9O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 2-acetamido-5-(diaminomethylideneamino)-N-[2-[5-(diaminomethylideneamino)pentan-2-ylamino]-2-oxoethyl]pentanamide |
| SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)NC(C)CCCN=C(N)N |
| InChI | InChI=1S/C16H33N9O3/c1-10(5-3-7-21-15(17)18)24-13(27)9-23-14(28)12(25-11(2)26)6-4-8-22-16(19)20/h10,12H,3-9H2,1-2H3,(H,23,28)(H,24,27)(H,25,26)(H4,17,18,21)(H4,19,20,22) |
| InChIKey | FZPUTPKUUGOZOT-UHFFFAOYSA-N |
| XLogP | -2.78 |
| TPSA | 216.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|