C17H33N9O4 — CID 59958587
(2R)-2-acetamido-6-(diaminomethylideneamino)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]hexanamide (PubChem CID 59958587) has the molecular formula C17H33N9O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is (2R)-2-acetamido-6-(diaminomethylideneamino)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]hexanamide.
| Compound Name | (2R)-2-acetamido-6-(diaminomethylideneamino)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 59958587 |
| Molecular Formula | C17H33N9O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | (2R)-2-acetamido-6-(diaminomethylideneamino)-N-[2-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-2-oxoethyl]hexanamide |
| SMILES | CC(=O)N[C@H](CCCCN=C(N)N)C(=O)NCC(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C17H33N9O4/c1-11(28)25-13(6-2-3-7-22-16(18)19)15(30)24-9-14(29)26-12(10-27)5-4-8-23-17(20)21/h10,12-13H,2-9H2,1H3,(H,24,30)(H,25,28)(H,26,29)(H4,18,19,22)(H4,20,21,23)/t12-,13+/m0/s1 |
| InChIKey | MTGLZSGUXOUCKK-QWHCGFSZSA-N |
| XLogP | -3.21 |
| TPSA | 233.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|