C20H37N9O6 — CID 127021028
(2S)-6-acetamido-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(2-oxoethyl)hexanamide (PubChem CID 127021028) has the molecular formula C20H37N9O6 and a molecular weight of 499.57 g/mol. Its IUPAC name is (2S)-6-acetamido-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(2-oxoethyl)hexanamide.
| Compound Name | (2S)-6-acetamido-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(2-oxoethyl)hexanamide |
|---|---|
| PubChem CID | 127021028 |
| Molecular Formula | C20H37N9O6 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | (2S)-6-acetamido-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]acetyl]amino]-N-(2-oxoethyl)hexanamide |
| SMILES | CC(=O)NCCCC[C@H](NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)CN)C(=O)NCC=O |
| InChI | InChI=1S/C20H37N9O6/c1-13(31)24-7-3-2-5-14(18(34)25-9-10-30)29-17(33)12-27-19(35)15(28-16(32)11-21)6-4-8-26-20(22)23/h10,14-15H,2-9,11-12,21H2,1H3,(H,24,31)(H,25,34)(H,27,35)(H,28,32)(H,29,33)(H4,22,23,26)/t14-,15-/m0/s1 |
| InChIKey | QNLQNKLHPYSKET-GJZGRUSLSA-N |
| XLogP | -4.29 |
| TPSA | 252.99 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | -4.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|