C13H25N7O6 — CID 175735323
(2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 175735323) has the molecular formula C13H25N7O6 and a molecular weight of 375.39 g/mol. Its IUPAC name is (2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 175735323 |
| Molecular Formula | C13H25N7O6 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | (2S)-2-[[2-[[(2S)-2-[(2-aminoacetyl)amino]-3-hydroxypropanoyl]amino]acetyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCC(=O)N[C@@H](CO)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C13H25N7O6/c14-4-9(22)20-8(6-21)11(24)18-5-10(23)19-7(12(25)26)2-1-3-17-13(15)16/h7-8,21H,1-6,14H2,(H,18,24)(H,19,23)(H,20,22)(H,25,26)(H4,15,16,17)/t7-,8-/m0/s1 |
| InChIKey | ATGCSOKZILFQPR-YUMQZZPRSA-N |
| XLogP | -4.84 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | -4.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|