C14H27N7O6 — CID 18235659
2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 18235659) has the molecular formula C14H27N7O6 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 18235659 |
| Molecular Formula | C14H27N7O6 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | 2-[[2-[[2-(2-aminopropanoylamino)acetyl]amino]-3-hydroxypropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(N)C(=O)NCC(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C14H27N7O6/c1-7(15)11(24)19-5-10(23)20-9(6-22)12(25)21-8(13(26)27)3-2-4-18-14(16)17/h7-9,22H,2-6,15H2,1H3,(H,19,24)(H,20,23)(H,21,25)(H,26,27)(H4,16,17,18) |
| InChIKey | ZTJUCGRSECXGDA-UHFFFAOYSA-N |
| XLogP | -4.45 |
| TPSA | 235.25 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | -4.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|