C11H22N6O3 — CID 123203466
(2S)-2-(3-aminopropanoylamino)-5-(diaminomethylideneamino)-N-(2-oxoethyl)pentanamide (PubChem CID 123203466) has the molecular formula C11H22N6O3 and a molecular weight of 286.34 g/mol. Its IUPAC name is (2S)-2-(3-aminopropanoylamino)-5-(diaminomethylideneamino)-N-(2-oxoethyl)pentanamide.
| Compound Name | (2S)-2-(3-aminopropanoylamino)-5-(diaminomethylideneamino)-N-(2-oxoethyl)pentanamide |
|---|---|
| PubChem CID | 123203466 |
| Molecular Formula | C11H22N6O3 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | (2S)-2-(3-aminopropanoylamino)-5-(diaminomethylideneamino)-N-(2-oxoethyl)pentanamide |
| SMILES | NCCC(=O)N[C@@H](CCCN=C(N)N)C(=O)NCC=O |
| InChI | InChI=1S/C11H22N6O3/c12-4-3-9(19)17-8(10(20)15-6-7-18)2-1-5-16-11(13)14/h7-8H,1-6,12H2,(H,15,20)(H,17,19)(H4,13,14,16)/t8-/m0/s1 |
| InChIKey | AEKJMOHSSGXWKQ-QMMMGPOBSA-N |
| XLogP | -2.81 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|