C28H56N12O6 — CID 16748482
(2S)-2-[5-[[(2S)-6-amino-2-[5-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]pentanoylamino]hexanoyl]amino]pentanoylamino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 16748482) has the molecular formula C28H56N12O6 and a molecular weight of 656.83 g/mol. Its IUPAC name is (2S)-2-[5-[[(2S)-6-amino-2-[5-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]pentanoylamino]hexanoyl]amino]pentanoylamino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[5-[[(2S)-6-amino-2-[5-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]pentanoylamino]hexanoyl]amino]pentanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 16748482 |
| Molecular Formula | C28H56N12O6 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.44 |
| IUPAC Name | (2S)-2-[5-[[(2S)-6-amino-2-[5-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]pentanoylamino]hexanoyl]amino]pentanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CCCCNC(=O)[C@@H](N)CCCN=C(N)N)C(=O)NCCCCC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C28H56N12O6/c29-14-4-1-10-20(39-22(41)12-2-5-15-35-24(43)19(30)9-7-17-37-27(31)32)25(44)36-16-6-3-13-23(42)40-21(26(45)46)11-8-18-38-28(33)34/h19-21H,1-18,29-30H2,(H,35,43)(H,36,44)(H,39,41)(H,40,42)(H,45,46)(H4,31,32,37)(H4,33,34,38)/t19-,20-,21-/m0/s1 |
| InChIKey | GJWBSWPCKORWSV-ACRUOGEOSA-N |
| XLogP | -2.82 |
| TPSA | 334.54 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|