C12H26N8O2 — CID 58616882
(2S)-5-(diaminomethylideneamino)-2-[5-(diaminomethylideneamino)pentanoylamino]pentanamide (PubChem CID 58616882) has the molecular formula C12H26N8O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[5-(diaminomethylideneamino)pentanoylamino]pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[5-(diaminomethylideneamino)pentanoylamino]pentanamide |
|---|---|
| PubChem CID | 58616882 |
| Molecular Formula | C12H26N8O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[5-(diaminomethylideneamino)pentanoylamino]pentanamide |
| SMILES | NC(=O)[C@H](CCCN=C(N)N)NC(=O)CCCCN=C(N)N |
| InChI | InChI=1S/C12H26N8O2/c13-10(22)8(4-3-7-19-12(16)17)20-9(21)5-1-2-6-18-11(14)15/h8H,1-7H2,(H2,13,22)(H,20,21)(H4,14,15,18)(H4,16,17,19)/t8-/m0/s1 |
| InChIKey | YGVQPSPHTOEEHT-QMMMGPOBSA-N |
| XLogP | -2.55 |
| TPSA | 200.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|