C14H26N4O5 — CID 118550139
8-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-8-oxooctanoic acid (PubChem CID 118550139) has the molecular formula C14H26N4O5 and a molecular weight of 330.39 g/mol. Its IUPAC name is 8-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-8-oxooctanoic acid.
| Compound Name | 8-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 118550139 |
| Molecular Formula | C14H26N4O5 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 8-[[(1S)-1-carboxy-4-(diaminomethylideneamino)butyl]amino]-8-oxooctanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)CCCCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C14H26N4O5/c15-14(16)17-9-5-6-10(13(22)23)18-11(19)7-3-1-2-4-8-12(20)21/h10H,1-9H2,(H,18,19)(H,20,21)(H,22,23)(H4,15,16,17)/t10-/m0/s1 |
| InChIKey | ITNUIUFXPZKAHH-JTQLQIEISA-N |
| XLogP | 0.03 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|