C14H28N4O5 — CID 123566302
5-(diaminomethylideneamino)-2-(8,8-dihydroxyoctanoylamino)pentanoic acid (PubChem CID 123566302) has the molecular formula C14H28N4O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-(8,8-dihydroxyoctanoylamino)pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-(8,8-dihydroxyoctanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 123566302 |
| Molecular Formula | C14H28N4O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-(8,8-dihydroxyoctanoylamino)pentanoic acid |
| SMILES | NC(N)=NCCCC(NC(=O)CCCCCCC(O)O)C(=O)O |
| InChI | InChI=1S/C14H28N4O5/c15-14(16)17-9-5-6-10(13(22)23)18-11(19)7-3-1-2-4-8-12(20)21/h10,12,20-21H,1-9H2,(H,18,19)(H,22,23)(H4,15,16,17) |
| InChIKey | MPRSJIASPMAVLD-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 171.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|