C8H14N4O4 — CID 173147392
(2S)-5-(diaminomethylideneamino)-2-(oxaldehydoylamino)pentanoic acid (PubChem CID 173147392) has the molecular formula C8H14N4O4 and a molecular weight of 230.22 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-(oxaldehydoylamino)pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-(oxaldehydoylamino)pentanoic acid |
|---|---|
| PubChem CID | 173147392 |
| Molecular Formula | C8H14N4O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(oxaldehydoylamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NC(=O)C=O)C(=O)O |
| InChI | InChI=1S/C8H14N4O4/c9-8(10)11-3-1-2-5(7(15)16)12-6(14)4-13/h4-5H,1-3H2,(H,12,14)(H,15,16)(H4,9,10,11)/t5-/m0/s1 |
| InChIKey | WXQLPTGIYOTGOT-YFKPBYRVSA-N |
| XLogP | -2.19 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|