C7H17N7O2 — CID 54407523
(2S)-2-[2-[amino(azanyl)methylidene]hydrazinyl]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 54407523) has the molecular formula C7H17N7O2 and a molecular weight of 233.25 g/mol. Its IUPAC name is (2S)-2-[2-[amino(azanyl)methylidene]hydrazinyl]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[2-[amino(azanyl)methylidene]hydrazinyl]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 54407523 |
| Molecular Formula | C7H17N7O2 |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (2S)-2-[2-[amino(azanyl)methylidene]hydrazinyl]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](N[15N]=C(N)[15NH2])C(=O)O |
| InChI | InChI=1S/C7H17N7O2/c8-6(9)12-3-1-2-4(5(15)16)13-14-7(10)11/h4,13H,1-3H2,(H,15,16)(H4,8,9,12)(H4,10,11,14)/t4-/m0/s1/i10+1,14+1 |
| InChIKey | VRTVCGMQWXYEIZ-CVEPPFBFSA-N |
| XLogP | -2.73 |
| TPSA | 178.13 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|