C6H15N5O4S — CID 71660635
(2S)-5-(diaminomethylideneamino)-2-(sulfamoylamino)pentanoic acid (PubChem CID 71660635) has the molecular formula C6H15N5O4S and a molecular weight of 253.28 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-(sulfamoylamino)pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-(sulfamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 71660635 |
| Molecular Formula | C6H15N5O4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(sulfamoylamino)pentanoic acid |
| SMILES | NC(N)=NCCC[C@H](NS(N)(=O)=O)C(=O)O |
| InChI | InChI=1S/C6H15N5O4S/c7-6(8)10-3-1-2-4(5(12)13)11-16(9,14)15/h4,11H,1-3H2,(H,12,13)(H4,7,8,10)(H2,9,14,15)/t4-/m0/s1 |
| InChIKey | PBEOTCYEZLQJNW-BYPYZUCNSA-N |
| XLogP | -2.71 |
| TPSA | 173.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|