C6H13N5O4 — CID 44593755
(2R)-5-(diaminomethylideneamino)-2-nitramidopentanoic acid (PubChem CID 44593755) has the molecular formula C6H13N5O4 and a molecular weight of 219.20 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-nitramidopentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-nitramidopentanoic acid |
|---|---|
| PubChem CID | 44593755 |
| Molecular Formula | C6H13N5O4 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-nitramidopentanoic acid |
| SMILES | NC(N)=NCCC[C@@H](N[N+](=O)[O-])C(=O)O |
| InChI | InChI=1S/C6H13N5O4/c7-6(8)9-3-1-2-4(5(12)13)10-11(14)15/h4,10H,1-3H2,(H,12,13)(H4,7,8,9)/t4-/m1/s1 |
| InChIKey | WRLUODMOTSXWIP-SCSAIBSYSA-N |
| XLogP | -1.73 |
| TPSA | 156.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|