C10H21N5O4 — CID 91023061
tert-butyl (2S)-5-(diaminomethylideneamino)-2-nitramidopentanoate (PubChem CID 91023061) has the molecular formula C10H21N5O4 and a molecular weight of 275.31 g/mol. Its IUPAC name is tert-butyl (2S)-5-(diaminomethylideneamino)-2-nitramidopentanoate.
| Compound Name | tert-butyl (2S)-5-(diaminomethylideneamino)-2-nitramidopentanoate |
|---|---|
| PubChem CID | 91023061 |
| Molecular Formula | C10H21N5O4 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | tert-butyl (2S)-5-(diaminomethylideneamino)-2-nitramidopentanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](CCCN=C(N)N)N[N+](=O)[O-] |
| InChI | InChI=1S/C10H21N5O4/c1-10(2,3)19-8(16)7(14-15(17)18)5-4-6-13-9(11)12/h7,14H,4-6H2,1-3H3,(H4,11,12,13)/t7-/m0/s1 |
| InChIKey | YSGCJBBDKDXIGX-ZETCQYMHSA-N |
| XLogP | -0.47 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|