C17H32N6O5 — CID 176596594
tert-butyl N-[5-(diaminomethylideneamino)-1-[(4-nitrocyclohexyl)amino]-1-oxopentan-2-yl]carbamate (PubChem CID 176596594) has the molecular formula C17H32N6O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl N-[5-(diaminomethylideneamino)-1-[(4-nitrocyclohexyl)amino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(diaminomethylideneamino)-1-[(4-nitrocyclohexyl)amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 176596594 |
| Molecular Formula | C17H32N6O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | tert-butyl N-[5-(diaminomethylideneamino)-1-[(4-nitrocyclohexyl)amino]-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCN=C(N)N)C(=O)NC1CCC([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H32N6O5/c1-17(2,3)28-16(25)22-13(5-4-10-20-15(18)19)14(24)21-11-6-8-12(9-7-11)23(26)27/h11-13H,4-10H2,1-3H3,(H,21,24)(H,22,25)(H4,18,19,20) |
| InChIKey | UWAWRZZOTUJKBC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 174.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|