C17H33N5O5 — CID 3833495
5-(diaminomethylideneamino)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]pentanoic acid (PubChem CID 3833495) has the molecular formula C17H33N5O5 and a molecular weight of 387.48 g/mol. Its IUPAC name is 5-(diaminomethylideneamino)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylideneamino)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 3833495 |
| Molecular Formula | C17H33N5O5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | 5-(diaminomethylideneamino)-2-[[4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoyl]amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C17H33N5O5/c1-10(2)9-12(22-16(26)27-17(3,4)5)13(23)21-11(14(24)25)7-6-8-20-15(18)19/h10-12H,6-9H2,1-5H3,(H,21,23)(H,22,26)(H,24,25)(H4,18,19,20) |
| InChIKey | MHYOQRMPMJSUFH-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 169.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|