C12H24N4O4 — CID 22227521
methyl 5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 22227521) has the molecular formula C12H24N4O4 and a molecular weight of 288.35 g/mol. Its IUPAC name is methyl 5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl 5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 22227521 |
| Molecular Formula | C12H24N4O4 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | methyl 5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | COC(=O)C(CCCN=C(N)N)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N4O4/c1-12(2,3)20-11(18)16-8(9(17)19-4)6-5-7-15-10(13)14/h8H,5-7H2,1-4H3,(H,16,18)(H4,13,14,15) |
| InChIKey | SQXMHHJVEHPDJY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|