C11H20FNO4 — CID 53419542
methyl 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 53419542) has the molecular formula C11H20FNO4 and a molecular weight of 249.28 g/mol. Its IUPAC name is methyl 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | methyl 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 53419542 |
| Molecular Formula | C11H20FNO4 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | methyl 5-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | COC(=O)C(CCCF)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H20FNO4/c1-11(2,3)17-10(15)13-8(6-5-7-12)9(14)16-4/h8H,5-7H2,1-4H3,(H,13,15) |
| InChIKey | ZXGZWEVPHSMUGQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |