C21H38FNO6 — CID 58185188
ditert-butyl (2S,4S)-2-(3-fluoropropyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate (PubChem CID 58185188) has the molecular formula C21H38FNO6 and a molecular weight of 419.53 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-(3-fluoropropyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate.
| Compound Name | ditert-butyl (2S,4S)-2-(3-fluoropropyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
|---|---|
| PubChem CID | 58185188 |
| Molecular Formula | C21H38FNO6 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | ditert-butyl (2S,4S)-2-(3-fluoropropyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@H](CCCF)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H38FNO6/c1-19(2,3)27-16(24)14(11-10-12-22)13-15(17(25)28-20(4,5)6)23-18(26)29-21(7,8)9/h14-15H,10-13H2,1-9H3,(H,23,26)/t14-,15-/m0/s1 |
| InChIKey | JPGRLLWCZOYESP-GJZGRUSLSA-N |
| XLogP | 4.32 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|