C27H43NO7 — CID 71249235
ditert-butyl (2S,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-phenoxypropyl)pentanedioate (PubChem CID 71249235) has the molecular formula C27H43NO7 and a molecular weight of 493.64 g/mol. Its IUPAC name is ditert-butyl (2S,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-phenoxypropyl)pentanedioate.
| Compound Name | ditert-butyl (2S,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-phenoxypropyl)pentanedioate |
|---|---|
| PubChem CID | 71249235 |
| Molecular Formula | C27H43NO7 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.30 |
| IUPAC Name | ditert-butyl (2S,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-phenoxypropyl)pentanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@H](CCCOc1ccccc1)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H43NO7/c1-25(2,3)33-22(29)19(14-13-17-32-20-15-11-10-12-16-20)18-21(23(30)34-26(4,5)6)28-24(31)35-27(7,8)9/h10-12,15-16,19,21H,13-14,17-18H2,1-9H3,(H,28,31)/t19-,21-/m0/s1 |
| InChIKey | CFSLGBPIWBJIKF-FPOVZHCZSA-N |
| XLogP | 5.43 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|