C22H41NO9S — CID 88947618
ditert-butyl (2R,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-methylsulfonyloxypropyl)pentanedioate (PubChem CID 88947618) has the molecular formula C22H41NO9S and a molecular weight of 495.64 g/mol. Its IUPAC name is ditert-butyl (2R,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-methylsulfonyloxypropyl)pentanedioate.
| Compound Name | ditert-butyl (2R,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-methylsulfonyloxypropyl)pentanedioate |
|---|---|
| PubChem CID | 88947618 |
| Molecular Formula | C22H41NO9S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | ditert-butyl (2R,4S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(3-methylsulfonyloxypropyl)pentanedioate |
| SMILES | CC(C)(C)OC(=O)N[C@H](C[C@H](CCCOS(C)(=O)=O)C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H41NO9S/c1-20(2,3)30-17(24)15(12-11-13-29-33(10,27)28)14-16(18(25)31-21(4,5)6)23-19(26)32-22(7,8)9/h15-16H,11-14H2,1-10H3,(H,23,26)/t15-,16+/m0/s1 |
| InChIKey | HUVJWPILFHDPIF-JKSUJKDBSA-N |
| XLogP | 3.33 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|