C20H32N2O6S — CID 87765209
[(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trimethylanilino)pentyl] methanesulfonate (PubChem CID 87765209) has the molecular formula C20H32N2O6S and a molecular weight of 428.55 g/mol. Its IUPAC name is [(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trimethylanilino)pentyl] methanesulfonate.
| Compound Name | [(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trimethylanilino)pentyl] methanesulfonate |
|---|---|
| PubChem CID | 87765209 |
| Molecular Formula | C20H32N2O6S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | [(4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(2,3,4-trimethylanilino)pentyl] methanesulfonate |
| SMILES | Cc1ccc(NC(=O)[C@@H](CCCOS(C)(=O)=O)NC(=O)OC(C)(C)C)c(C)c1C |
| InChI | InChI=1S/C20H32N2O6S/c1-13-10-11-16(15(3)14(13)2)21-18(23)17(9-8-12-27-29(7,25)26)22-19(24)28-20(4,5)6/h10-11,17H,8-9,12H2,1-7H3,(H,21,23)(H,22,24)/t17-/m1/s1 |
| InChIKey | XQPMODZJNVUPPB-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|