C17H25NO7S — CID 25212959
benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxybutanoate (PubChem CID 25212959) has the molecular formula C17H25NO7S and a molecular weight of 387.45 g/mol. Its IUPAC name is benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxybutanoate.
| Compound Name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxybutanoate |
|---|---|
| PubChem CID | 25212959 |
| Molecular Formula | C17H25NO7S |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | benzyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-methylsulfonyloxybutanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCOS(C)(=O)=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25NO7S/c1-17(2,3)25-16(20)18-14(10-11-24-26(4,21)22)15(19)23-12-13-8-6-5-7-9-13/h5-9,14H,10-12H2,1-4H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | BMVABMINAPAVTG-AWEZNQCLSA-N |
| XLogP | 1.99 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|