C11H23NO5S — CID 86612321
4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl methanesulfonate (PubChem CID 86612321) has the molecular formula C11H23NO5S and a molecular weight of 281.37 g/mol. Its IUPAC name is 4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl methanesulfonate.
| Compound Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl methanesulfonate |
|---|---|
| PubChem CID | 86612321 |
| Molecular Formula | C11H23NO5S |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl methanesulfonate |
| SMILES | CC(CCCOS(C)(=O)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO5S/c1-9(7-6-8-16-18(5,14)15)12-10(13)17-11(2,3)4/h9H,6-8H2,1-5H3,(H,12,13) |
| InChIKey | HWCYYKQWHFZLPH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|