C12H27ClN2O2 — CID 167718807
tert-butyl N-[(2R)-7-aminoheptan-2-yl]carbamate;hydrochloride (PubChem CID 167718807) has the molecular formula C12H27ClN2O2 and a molecular weight of 266.81 g/mol. Its IUPAC name is tert-butyl N-[(2R)-7-aminoheptan-2-yl]carbamate;hydrochloride.
| Compound Name | tert-butyl N-[(2R)-7-aminoheptan-2-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 167718807 |
| Molecular Formula | C12H27ClN2O2 |
| Molecular Weight | 266.81 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | tert-butyl N-[(2R)-7-aminoheptan-2-yl]carbamate;hydrochloride |
| SMILES | C[C@H](CCCCCN)NC(=O)OC(C)(C)C.Cl |
| InChI | InChI=1S/C12H26N2O2.ClH/c1-10(8-6-5-7-9-13)14-11(15)16-12(2,3)4;/h10H,5-9,13H2,1-4H3,(H,14,15);1H/t10-;/m1./s1 |
| InChIKey | QPESTCASUMVTIA-HNCPQSOCSA-N |
| XLogP | 2.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|