C13H26N2O4 — CID 145364807
methyl (2S)-7-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate (PubChem CID 145364807) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is methyl (2S)-7-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate.
| Compound Name | methyl (2S)-7-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate |
|---|---|
| PubChem CID | 145364807 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | methyl (2S)-7-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]heptanoate |
| SMILES | COC(=O)[C@H](CCCCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26N2O4/c1-13(2,3)19-12(17)15-10(11(16)18-4)8-6-5-7-9-14/h10H,5-9,14H2,1-4H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | BGPWHLAJDDRUAH-JTQLQIEISA-N |
| XLogP | 1.57 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|