C14H27N3O5 — CID 54307119
methyl 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]acetate (PubChem CID 54307119) has the molecular formula C14H27N3O5 and a molecular weight of 317.39 g/mol. Its IUPAC name is methyl 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]acetate |
|---|---|
| PubChem CID | 54307119 |
| Molecular Formula | C14H27N3O5 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | methyl 2-[[(2S)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](CCCCN)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H27N3O5/c1-14(2,3)22-13(20)17-10(7-5-6-8-15)12(19)16-9-11(18)21-4/h10H,5-9,15H2,1-4H3,(H,16,19)(H,17,20)/t10-/m0/s1 |
| InChIKey | SIHLLORMZCQICX-JTQLQIEISA-N |
| XLogP | 0.30 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|