C11H19N3O6 — CID 46863110
2-[[(2S)-6-amino-1-[(2-methoxy-2-oxoethyl)amino]-1-oxohexan-2-yl]amino]-2-oxoacetic acid (PubChem CID 46863110) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-1-[(2-methoxy-2-oxoethyl)amino]-1-oxohexan-2-yl]amino]-2-oxoacetic acid.
| Compound Name | 2-[[(2S)-6-amino-1-[(2-methoxy-2-oxoethyl)amino]-1-oxohexan-2-yl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 46863110 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-[[(2S)-6-amino-1-[(2-methoxy-2-oxoethyl)amino]-1-oxohexan-2-yl]amino]-2-oxoacetic acid |
| SMILES | COC(=O)CNC(=O)[C@H](CCCCN)NC(=O)C(=O)O |
| InChI | InChI=1S/C11H19N3O6/c1-20-8(15)6-13-9(16)7(4-2-3-5-12)14-10(17)11(18)19/h7H,2-6,12H2,1H3,(H,13,16)(H,14,17)(H,18,19)/t7-/m0/s1 |
| InChIKey | ILELECHCMZSJKX-ZETCQYMHSA-N |
| XLogP | -2.03 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|