C13H26N4O4 — CID 18232429
2-[[6-amino-2-[(2-amino-3-methylbutanoyl)amino]hexanoyl]amino]acetic acid (PubChem CID 18232429) has the molecular formula C13H26N4O4 and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-[[6-amino-2-[(2-amino-3-methylbutanoyl)amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[(2-amino-3-methylbutanoyl)amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18232429 |
| Molecular Formula | C13H26N4O4 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 2-[[6-amino-2-[(2-amino-3-methylbutanoyl)amino]hexanoyl]amino]acetic acid |
| SMILES | CC(C)C(N)C(=O)NC(CCCCN)C(=O)NCC(=O)O |
| InChI | InChI=1S/C13H26N4O4/c1-8(2)11(15)13(21)17-9(5-3-4-6-14)12(20)16-7-10(18)19/h8-9,11H,3-7,14-15H2,1-2H3,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | DIOSYUIWOQCXNR-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|