C14H27N5O6 — CID 18238756
2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]acetic acid (PubChem CID 18238756) has the molecular formula C14H27N5O6 and a molecular weight of 361.40 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18238756 |
| Molecular Formula | C14H27N5O6 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 2-[[6-amino-2-[[2-(2-aminopropanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]acetic acid |
| SMILES | CC(N)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)NCC(=O)O |
| InChI | InChI=1S/C14H27N5O6/c1-8(16)12(23)19-10(7-20)14(25)18-9(4-2-3-5-15)13(24)17-6-11(21)22/h8-10,20H,2-7,15-16H2,1H3,(H,17,24)(H,18,25)(H,19,23)(H,21,22) |
| InChIKey | PWHARPPPFOARFH-UHFFFAOYSA-N |
| XLogP | -3.37 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|