C14H27N5O6S — CID 18259180
2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]acetic acid (PubChem CID 18259180) has the molecular formula C14H27N5O6S and a molecular weight of 393.47 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18259180 |
| Molecular Formula | C14H27N5O6S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]acetic acid |
| SMILES | NCCCCC(NC(=O)C(N)CS)C(=O)NC(CO)C(=O)NCC(=O)O |
| InChI | InChI=1S/C14H27N5O6S/c15-4-2-1-3-9(18-12(23)8(16)7-26)14(25)19-10(6-20)13(24)17-5-11(21)22/h8-10,20,26H,1-7,15-16H2,(H,17,24)(H,18,23)(H,19,25)(H,21,22) |
| InChIKey | QGWLOYVVTNZYGM-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|