C15H27N5O7S — CID 18250981
3-amino-4-[[6-amino-1-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 18250981) has the molecular formula C15H27N5O7S and a molecular weight of 421.48 g/mol. Its IUPAC name is 3-amino-4-[[6-amino-1-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[[6-amino-1-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18250981 |
| Molecular Formula | C15H27N5O7S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-amino-4-[[6-amino-1-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CC(=O)O)C(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C15H27N5O7S/c16-4-2-1-3-9(19-13(25)8(17)5-11(21)22)15(27)20-10(7-28)14(26)18-6-12(23)24/h8-10,28H,1-7,16-17H2,(H,18,26)(H,19,25)(H,20,27)(H,21,22)(H,23,24) |
| InChIKey | SNLXOWFMRCWBRW-UHFFFAOYSA-N |
| XLogP | -2.98 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|