C14H26N6O6 — CID 22656614
2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]acetyl]amino]acetic acid (PubChem CID 22656614) has the molecular formula C14H26N6O6 and a molecular weight of 374.40 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 22656614 |
| Molecular Formula | C14H26N6O6 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]hexanoyl]amino]acetyl]amino]acetic acid |
| SMILES | NCCCCC(NC(=O)C(N)CC(N)=O)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C14H26N6O6/c15-4-2-1-3-9(20-13(25)8(16)5-10(17)21)14(26)19-6-11(22)18-7-12(23)24/h8-9H,1-7,15-16H2,(H2,17,21)(H,18,22)(H,19,26)(H,20,25)(H,23,24) |
| InChIKey | OZZACKHDNQVXGU-UHFFFAOYSA-N |
| XLogP | -3.88 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|