C17H31N7O7 — CID 22701595
2-[[6-amino-2-[[4-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]acetic acid (PubChem CID 22701595) has the molecular formula C17H31N7O7 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-[[6-amino-2-[[4-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]acetic acid.
| Compound Name | 2-[[6-amino-2-[[4-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 22701595 |
| Molecular Formula | C17H31N7O7 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2-[[6-amino-2-[[4-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]-4-oxobutanoyl]amino]hexanoyl]amino]acetic acid |
| SMILES | NCCCCC(NC(=O)C(CC(N)=O)NC(=O)C(N)CCC(N)=O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C17H31N7O7/c18-6-2-1-3-10(16(30)22-8-14(27)28)23-17(31)11(7-13(21)26)24-15(29)9(19)4-5-12(20)25/h9-11H,1-8,18-19H2,(H2,20,25)(H2,21,26)(H,22,30)(H,23,31)(H,24,29)(H,27,28) |
| InChIKey | QGHMVKKTACFMCE-UHFFFAOYSA-N |
| XLogP | -4.25 |
| TPSA | 262.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | -4.25 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|