C17H33N5O5S — CID 18306354
2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid (PubChem CID 18306354) has the molecular formula C17H33N5O5S and a molecular weight of 419.55 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 18306354 |
| Molecular Formula | C17H33N5O5S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]acetic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCCN)C(=O)NC(CS)C(=O)NCC(=O)O |
| InChI | InChI=1S/C17H33N5O5S/c1-10(2)7-12(21-15(25)11(19)5-3-4-6-18)17(27)22-13(9-28)16(26)20-8-14(23)24/h10-13,28H,3-9,18-19H2,1-2H3,(H,20,26)(H,21,25)(H,22,27)(H,23,24) |
| InChIKey | XDOYREJAIHOKDY-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|