C17H30N4O7 — CID 134817017
(3S)-3-acetamido-4-[[(2S)-6-amino-1-[(4-methoxy-4-oxobutyl)amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 134817017) has the molecular formula C17H30N4O7 and a molecular weight of 402.45 g/mol. Its IUPAC name is (3S)-3-acetamido-4-[[(2S)-6-amino-1-[(4-methoxy-4-oxobutyl)amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-acetamido-4-[[(2S)-6-amino-1-[(4-methoxy-4-oxobutyl)amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134817017 |
| Molecular Formula | C17H30N4O7 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (3S)-3-acetamido-4-[[(2S)-6-amino-1-[(4-methoxy-4-oxobutyl)amino]-1-oxohexan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | COC(=O)CCCNC(=O)[C@H](CCCCN)NC(=O)[C@H](CC(=O)O)NC(C)=O |
| InChI | InChI=1S/C17H30N4O7/c1-11(22)20-13(10-14(23)24)17(27)21-12(6-3-4-8-18)16(26)19-9-5-7-15(25)28-2/h12-13H,3-10,18H2,1-2H3,(H,19,26)(H,20,22)(H,21,27)(H,23,24)/t12-,13-/m0/s1 |
| InChIKey | RRRUNLKJWVXHPL-STQMWFEESA-N |
| XLogP | -1.35 |
| TPSA | 176.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|