C20H36N6O7 — CID 102073607
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid (PubChem CID 102073607) has the molecular formula C20H36N6O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 102073607 |
| Molecular Formula | C20H36N6O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-acetamido-6-aminohexanoyl]amino]propanoyl]amino]propanoyl]amino]propanoyl]amino]propanoic acid |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C20H36N6O7/c1-10(16(28)23-11(2)18(30)25-13(4)20(32)33)22-17(29)12(3)24-19(31)15(26-14(5)27)8-6-7-9-21/h10-13,15H,6-9,21H2,1-5H3,(H,22,29)(H,23,28)(H,24,31)(H,25,30)(H,26,27)(H,32,33)/t10-,11-,12-,13-,15-/m0/s1 |
| InChIKey | YPNFCCCGCUGPAE-CXOVXGEYSA-N |
| XLogP | -2.28 |
| TPSA | 208.82 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|