C18H38N6O3 — CID 72708054
(2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-(4-aminobutylamino)-1-oxohexan-2-yl]hexanamide (PubChem CID 72708054) has the molecular formula C18H38N6O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is (2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-(4-aminobutylamino)-1-oxohexan-2-yl]hexanamide.
| Compound Name | (2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-(4-aminobutylamino)-1-oxohexan-2-yl]hexanamide |
|---|---|
| PubChem CID | 72708054 |
| Molecular Formula | C18H38N6O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | (2S)-2-acetamido-6-amino-N-[(2S)-6-amino-1-(4-aminobutylamino)-1-oxohexan-2-yl]hexanamide |
| SMILES | CC(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)NCCCCN |
| InChI | InChI=1S/C18H38N6O3/c1-14(25)23-16(9-3-5-11-20)18(27)24-15(8-2-4-10-19)17(26)22-13-7-6-12-21/h15-16H,2-13,19-21H2,1H3,(H,22,26)(H,23,25)(H,24,27)/t15-,16-/m0/s1 |
| InChIKey | CJTZXFPJBOELIO-HOTGVXAUSA-N |
| XLogP | -0.91 |
| TPSA | 165.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|