C8H17N3O2 — CID 7021885
(2S)-2-acetamido-6-aminohexanamide (PubChem CID 7021885) has the molecular formula C8H17N3O2 and a molecular weight of 187.24 g/mol. Its IUPAC name is (2S)-2-acetamido-6-aminohexanamide.
| Compound Name | (2S)-2-acetamido-6-aminohexanamide |
|---|---|
| PubChem CID | 7021885 |
| Molecular Formula | C8H17N3O2 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.13 |
| IUPAC Name | (2S)-2-acetamido-6-aminohexanamide |
| SMILES | CC(=O)N[C@@H](CCCCN)C(N)=O |
| InChI | InChI=1S/C8H17N3O2/c1-6(12)11-7(8(10)13)4-2-3-5-9/h7H,2-5,9H2,1H3,(H2,10,13)(H,11,12)/t7-/m0/s1 |
| InChIKey | RXDBWNXJJIDFEF-ZETCQYMHSA-N |
| XLogP | -0.89 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|