About 2-acetamidopentanamide
2-acetamidopentanamide (PubChem CID 23273489) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2-acetamidopentanamide.
Molecular Properties
| Compound Name | 2-acetamidopentanamide |
| PubChem CID | 23273489 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | 2-acetamidopentanamide |
| SMILES | CCCC(NC(C)=O)C(N)=O |
| InChI | InChI=1S/C7H14N2O2/c1-3-4-6(7(8)11)9-5(2)10/h6H,3-4H2,1-2H3,(H2,8,11)(H,9,10) |
| InChIKey | YTSHGSYIVIAYAS-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-acetamidopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamidopentanamide?
The IUPAC name of 2-acetamidopentanamide (CID 23273489) is 2-acetamidopentanamide.
What is the SMILES notation for 2-acetamidopentanamide?
The canonical SMILES for 2-acetamidopentanamide is CCCC(NC(C)=O)C(N)=O.
What is the InChIKey of 2-acetamidopentanamide?
The InChIKey is YTSHGSYIVIAYAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-3-4-6(7(8)11)9-5(2)10/h6H,3-4H2,1-2H3,(H2,8,11)(H,9,10).
What are the key properties of 2-acetamidopentanamide?
2-acetamidopentanamide has a molecular weight of 158.20 g/mol, XLogP of -0.22, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamidopentanamide is sourced from PubChem (CID 23273489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).