C8H16N2O3 — CID 56997535
(2S)-2-[(1-amino-1-oxopentan-2-yl)amino]propanoic acid (PubChem CID 56997535) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is (2S)-2-[(1-amino-1-oxopentan-2-yl)amino]propanoic acid.
| Compound Name | (2S)-2-[(1-amino-1-oxopentan-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 56997535 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (2S)-2-[(1-amino-1-oxopentan-2-yl)amino]propanoic acid |
| SMILES | CCCC(N[C@@H](C)C(=O)O)C(N)=O |
| InChI | InChI=1S/C8H16N2O3/c1-3-4-6(7(9)11)10-5(2)8(12)13/h5-6,10H,3-4H2,1-2H3,(H2,9,11)(H,12,13)/t5-,6?/m0/s1 |
| InChIKey | IVZAXCFCVYHJJX-ZBHICJROSA-N |
| XLogP | -0.30 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |