C10H19NO4 — CID 41092480
(2S)-2-[[(2R)-1-ethoxy-1-oxopentan-2-yl]amino]propanoic acid (PubChem CID 41092480) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is (2S)-2-[[(2R)-1-ethoxy-1-oxopentan-2-yl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2R)-1-ethoxy-1-oxopentan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 41092480 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | (2S)-2-[[(2R)-1-ethoxy-1-oxopentan-2-yl]amino]propanoic acid |
| SMILES | CCC[C@@H](N[C@@H](C)C(=O)O)C(=O)OCC |
| InChI | InChI=1S/C10H19NO4/c1-4-6-8(10(14)15-5-2)11-7(3)9(12)13/h7-8,11H,4-6H2,1-3H3,(H,12,13)/t7-,8+/m0/s1 |
| InChIKey | AUVAVXHAOCLQBF-JGVFFNPUSA-N |
| XLogP | 0.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |