C17H31NO6S — CID 56624994
(2S)-2-[[(2R)-1-ethoxy-3-[(2R)-1-ethoxy-1-oxoheptan-2-yl]sulfanyl-1-oxopropan-2-yl]amino]propanoic acid (PubChem CID 56624994) has the molecular formula C17H31NO6S and a molecular weight of 377.50 g/mol. Its IUPAC name is (2S)-2-[[(2R)-1-ethoxy-3-[(2R)-1-ethoxy-1-oxoheptan-2-yl]sulfanyl-1-oxopropan-2-yl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2R)-1-ethoxy-3-[(2R)-1-ethoxy-1-oxoheptan-2-yl]sulfanyl-1-oxopropan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 56624994 |
| Molecular Formula | C17H31NO6S |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | (2S)-2-[[(2R)-1-ethoxy-3-[(2R)-1-ethoxy-1-oxoheptan-2-yl]sulfanyl-1-oxopropan-2-yl]amino]propanoic acid |
| SMILES | CCCCC[C@@H](SC[C@H](N[C@@H](C)C(=O)O)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C17H31NO6S/c1-5-8-9-10-14(17(22)24-7-3)25-11-13(16(21)23-6-2)18-12(4)15(19)20/h12-14,18H,5-11H2,1-4H3,(H,19,20)/t12-,13-,14+/m0/s1 |
| InChIKey | PVMVHKIEEYDNKB-MELADBBJSA-N |
| XLogP | 2.23 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|