C10H17NO5S — CID 64663170
3-(1-ethoxy-1-oxobutan-2-yl)sulfanyl-2-formamidopropanoic acid (PubChem CID 64663170) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is 3-(1-ethoxy-1-oxobutan-2-yl)sulfanyl-2-formamidopropanoic acid.
| Compound Name | 3-(1-ethoxy-1-oxobutan-2-yl)sulfanyl-2-formamidopropanoic acid |
|---|---|
| PubChem CID | 64663170 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-(1-ethoxy-1-oxobutan-2-yl)sulfanyl-2-formamidopropanoic acid |
| SMILES | CCOC(=O)C(CC)SCC(NC=O)C(=O)O |
| InChI | InChI=1S/C10H17NO5S/c1-3-8(10(15)16-4-2)17-5-7(9(13)14)11-6-12/h6-8H,3-5H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | LUUHYYNDOSQBHO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|