C20H31NO4 — CID 56615975
(2S)-2-[[(2S)-1-oxo-1-phenylmethoxydecan-2-yl]amino]propanoic acid (PubChem CID 56615975) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (2S)-2-[[(2S)-1-oxo-1-phenylmethoxydecan-2-yl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-1-oxo-1-phenylmethoxydecan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 56615975 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (2S)-2-[[(2S)-1-oxo-1-phenylmethoxydecan-2-yl]amino]propanoic acid |
| SMILES | CCCCCCCC[C@H](N[C@@H](C)C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H31NO4/c1-3-4-5-6-7-11-14-18(21-16(2)19(22)23)20(24)25-15-17-12-9-8-10-13-17/h8-10,12-13,16,18,21H,3-7,11,14-15H2,1-2H3,(H,22,23)/t16-,18-/m0/s1 |
| InChIKey | CLONJLCAAVFZIW-WMZOPIPTSA-N |
| XLogP | 3.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|