C21H23NO6 — CID 67659703
2-[[(2S)-1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]propanoic acid (PubChem CID 67659703) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[[(2S)-1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]propanoic acid.
| Compound Name | 2-[[(2S)-1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 67659703 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-[[(2S)-1,4-dioxo-1,4-bis(phenylmethoxy)butan-2-yl]amino]propanoic acid |
| SMILES | CC(N[C@@H](CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H23NO6/c1-15(20(24)25)22-18(21(26)28-14-17-10-6-3-7-11-17)12-19(23)27-13-16-8-4-2-5-9-16/h2-11,15,18,22H,12-14H2,1H3,(H,24,25)/t15?,18-/m0/s1 |
| InChIKey | CNBTWUJWRWQKOF-PKHIMPSTSA-N |
| XLogP | 2.29 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |