C22H24N2O6 — CID 7322838
dibenzyl (2R)-2-[(2-acetamidoacetyl)amino]butanedioate (PubChem CID 7322838) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is dibenzyl (2R)-2-[(2-acetamidoacetyl)amino]butanedioate.
| Compound Name | dibenzyl (2R)-2-[(2-acetamidoacetyl)amino]butanedioate |
|---|---|
| PubChem CID | 7322838 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | dibenzyl (2R)-2-[(2-acetamidoacetyl)amino]butanedioate |
| SMILES | CC(=O)NCC(=O)N[C@H](CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H24N2O6/c1-16(25)23-13-20(26)24-19(22(28)30-15-18-10-6-3-7-11-18)12-21(27)29-14-17-8-4-2-5-9-17/h2-11,19H,12-15H2,1H3,(H,23,25)(H,24,26)/t19-/m1/s1 |
| InChIKey | XHPKUGGCQFHQPX-LJQANCHMSA-N |
| XLogP | 1.48 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |