C25H32N2O6 — CID 58688061
dibenzyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]butanedioate (PubChem CID 58688061) has the molecular formula C25H32N2O6 and a molecular weight of 456.54 g/mol. Its IUPAC name is dibenzyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]butanedioate.
| Compound Name | dibenzyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]butanedioate |
|---|---|
| PubChem CID | 58688061 |
| Molecular Formula | C25H32N2O6 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | dibenzyl 2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]butanedioate |
| SMILES | CC(C)(C)OC(=O)NCCNC(CC(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H32N2O6/c1-25(2,3)33-24(30)27-15-14-26-21(23(29)32-18-20-12-8-5-9-13-20)16-22(28)31-17-19-10-6-4-7-11-19/h4-13,21,26H,14-18H2,1-3H3,(H,27,30) |
| InChIKey | HZVBTHQHJWECRB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|